C7H14O — CID 129313541
(4R)-2,4-dimethyloxane (PubChem CID 129313541) has the molecular formula C7H14O and a molecular weight of 114.19 g/mol. Its IUPAC name is (4R)-2,4-dimethyloxane.
| Compound Name | (4R)-2,4-dimethyloxane |
|---|---|
| PubChem CID | 129313541 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | (4R)-2,4-dimethyloxane |
| SMILES | CC1C[C@H](C)CCO1 |
| InChI | InChI=1S/C7H14O/c1-6-3-4-8-7(2)5-6/h6-7H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | FPQOQDFWCJXVKF-ULUSZKPHSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |