C10H22O2 — CID 145468065
2,4-dimethyloxane;ethene;methanol (PubChem CID 145468065) has the molecular formula C10H22O2 and a molecular weight of 174.28 g/mol. Its IUPAC name is 2,4-dimethyloxane;ethene;methanol.
| Compound Name | 2,4-dimethyloxane;ethene;methanol |
|---|---|
| PubChem CID | 145468065 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 2,4-dimethyloxane;ethene;methanol |
| SMILES | C=C.CC1CCOC(C)C1.CO |
| InChI | InChI=1S/C7H14O.C2H4.CH4O/c1-6-3-4-8-7(2)5-6;2*1-2/h6-7H,3-5H2,1-2H3;1-2H2;2H,1H3 |
| InChIKey | KIAQLKODESBOTF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|