About acetonitrile;2,4-dimethyloxane
acetonitrile;2,4-dimethyloxane (PubChem CID 144710823) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is acetonitrile;2,4-dimethyloxane.
Molecular Properties
| Compound Name | acetonitrile;2,4-dimethyloxane |
| PubChem CID | 144710823 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | acetonitrile;2,4-dimethyloxane |
| SMILES | CC#N.CC1CCOC(C)C1 |
| InChI | InChI=1S/C7H14O.C2H3N/c1-6-3-4-8-7(2)5-6;1-2-3/h6-7H,3-5H2,1-2H3;1H3 |
| InChIKey | YHFVROHXZXCOHM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;2,4-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2,4-dimethyloxane?
The IUPAC name of acetonitrile;2,4-dimethyloxane (CID 144710823) is acetonitrile;2,4-dimethyloxane.
What is the SMILES notation for acetonitrile;2,4-dimethyloxane?
The canonical SMILES for acetonitrile;2,4-dimethyloxane is CC#N.CC1CCOC(C)C1.
What is the InChIKey of acetonitrile;2,4-dimethyloxane?
The InChIKey is YHFVROHXZXCOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C2H3N/c1-6-3-4-8-7(2)5-6;1-2-3/h6-7H,3-5H2,1-2H3;1H3.
What are the key properties of acetonitrile;2,4-dimethyloxane?
acetonitrile;2,4-dimethyloxane has a molecular weight of 155.24 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2,4-dimethyloxane is sourced from PubChem (CID 144710823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).