C12H21ClO — CID 102310949
(2S,4R)-4-chloro-2-cyclohexyloxepane (PubChem CID 102310949) has the molecular formula C12H21ClO and a molecular weight of 216.75 g/mol. Its IUPAC name is (2S,4R)-4-chloro-2-cyclohexyloxepane.
| Compound Name | (2S,4R)-4-chloro-2-cyclohexyloxepane |
|---|---|
| PubChem CID | 102310949 |
| Molecular Formula | C12H21ClO |
| Molecular Weight | 216.75 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2S,4R)-4-chloro-2-cyclohexyloxepane |
| SMILES | Cl[C@@H]1CCCO[C@H](C2CCCCC2)C1 |
| InChI | InChI=1S/C12H21ClO/c13-11-7-4-8-14-12(9-11)10-5-2-1-3-6-10/h10-12H,1-9H2/t11-,12+/m1/s1 |
| InChIKey | VWIZIHKNFONFPK-NEPJUHHUSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|