C12H23FO5 — CID 167510900
4-[(2S,3R)-3-fluorooxolan-2-yl]-2,2-dimethyl-1,3-dioxolane;propane-2,2-diol (PubChem CID 167510900) has the molecular formula C12H23FO5 and a molecular weight of 266.31 g/mol. Its IUPAC name is 4-[(2S,3R)-3-fluorooxolan-2-yl]-2,2-dimethyl-1,3-dioxolane;propane-2,2-diol.
| Compound Name | 4-[(2S,3R)-3-fluorooxolan-2-yl]-2,2-dimethyl-1,3-dioxolane;propane-2,2-diol |
|---|---|
| PubChem CID | 167510900 |
| Molecular Formula | C12H23FO5 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-[(2S,3R)-3-fluorooxolan-2-yl]-2,2-dimethyl-1,3-dioxolane;propane-2,2-diol |
| SMILES | CC(C)(O)O.CC1(C)OCC([C@@H]2OCC[C@H]2F)O1 |
| InChI | InChI=1S/C9H15FO3.C3H8O2/c1-9(2)12-5-7(13-9)8-6(10)3-4-11-8;1-3(2,4)5/h6-8H,3-5H2,1-2H3;4-5H,1-2H3/t6-,7?,8-;/m1./s1 |
| InChIKey | MWHIPTRGAUNROU-MZLLXOAPSA-N |
| XLogP | 0.97 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|