C12H18F4O4S — CID 101403612
[(2S,4S,5R)-2-cyclohexyl-5-fluorooxan-4-yl] trifluoromethanesulfonate (PubChem CID 101403612) has the molecular formula C12H18F4O4S and a molecular weight of 334.33 g/mol. Its IUPAC name is [(2S,4S,5R)-2-cyclohexyl-5-fluorooxan-4-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,4S,5R)-2-cyclohexyl-5-fluorooxan-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101403612 |
| Molecular Formula | C12H18F4O4S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [(2S,4S,5R)-2-cyclohexyl-5-fluorooxan-4-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[C@H]1C[C@@H](C2CCCCC2)OC[C@H]1F)C(F)(F)F |
| InChI | InChI=1S/C12H18F4O4S/c13-9-7-19-10(8-4-2-1-3-5-8)6-11(9)20-21(17,18)12(14,15)16/h8-11H,1-7H2/t9-,10+,11+/m1/s1 |
| InChIKey | DSOXNFMJBZGHCP-VWYCJHECSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|