C13H18O7S — CID 58165484
[1,7-bis(hydroxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylprop-2-enoate (PubChem CID 58165484) has the molecular formula C13H18O7S and a molecular weight of 318.35 g/mol. Its IUPAC name is [1,7-bis(hydroxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1,7-bis(hydroxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58165484 |
| Molecular Formula | C13H18O7S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [1,7-bis(hydroxymethyl)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2OS(=O)(=O)C3CC1(CO)CC23CO |
| InChI | InChI=1S/C13H18O7S/c1-7(2)11(16)19-9-10-13(6-15)4-12(9,5-14)3-8(13)21(17,18)20-10/h8-10,14-15H,1,3-6H2,2H3 |
| InChIKey | NDIUNIRRZCRDAP-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|