C14H16O6S — CID 59623395
[2-[(3-methyl-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 59623395) has the molecular formula C14H16O6S and a molecular weight of 312.34 g/mol. Its IUPAC name is [2-[(3-methyl-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[(3-methyl-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59623395 |
| Molecular Formula | C14H16O6S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | [2-[(3-methyl-5-oxo-4-oxa-8-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1C2CC3C(=O)OC1(C)C3S2 |
| InChI | InChI=1S/C14H16O6S/c1-6(2)12(16)18-5-9(15)19-10-8-4-7-11(21-8)14(10,3)20-13(7)17/h7-8,10-11H,1,4-5H2,2-3H3 |
| InChIKey | QVYIUDUCYLGCKZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|