C8H11IO3S — CID 155094464
9-iodo-7-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide (PubChem CID 155094464) has the molecular formula C8H11IO3S and a molecular weight of 314.14 g/mol. Its IUPAC name is 9-iodo-7-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide.
| Compound Name | 9-iodo-7-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
|---|---|
| PubChem CID | 155094464 |
| Molecular Formula | C8H11IO3S |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | 9-iodo-7-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
| SMILES | CC12CC3CC1OS(=O)(=O)C2C3I |
| InChI | InChI=1S/C8H11IO3S/c1-8-3-4-2-5(8)12-13(10,11)7(8)6(4)9/h4-7H,2-3H2,1H3 |
| InChIKey | PEEVUDUKPOZWPW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|