C9H10O3S — CID 163856276
3-oxa-4λ6-thiapentacyclo[5.3.1.01,5.02,10.08,10]undecane 4,4-dioxide (PubChem CID 163856276) has the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. Its IUPAC name is 3-oxa-4λ6-thiapentacyclo[5.3.1.01,5.02,10.08,10]undecane 4,4-dioxide.
| Compound Name | 3-oxa-4λ6-thiapentacyclo[5.3.1.01,5.02,10.08,10]undecane 4,4-dioxide |
|---|---|
| PubChem CID | 163856276 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3-oxa-4λ6-thiapentacyclo[5.3.1.01,5.02,10.08,10]undecane 4,4-dioxide |
| SMILES | O=S1(=O)OC2C34CC3C3CC1C24C3 |
| InChI | InChI=1S/C9H10O3S/c10-13(11)6-1-4-2-9(6)7(12-13)8(9)3-5(4)8/h4-7H,1-3H2 |
| InChIKey | OYOPTDGRYYHHSP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|