C18H29NO7S — CID 147937762
2-[[2-[(7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]acetyl]amino]ethyl 2,2-dimethylbutanoate (PubChem CID 147937762) has the molecular formula C18H29NO7S and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-[[2-[(7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]acetyl]amino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[2-[(7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]acetyl]amino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 147937762 |
| Molecular Formula | C18H29NO7S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-[[2-[(7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]acetyl]amino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)COC1C2CC3C(C)(C2)C1OS3(=O)=O |
| InChI | InChI=1S/C18H29NO7S/c1-5-17(2,3)16(21)24-7-6-19-13(20)10-25-14-11-8-12-18(4,9-11)15(14)26-27(12,22)23/h11-12,14-15H,5-10H2,1-4H3,(H,19,20) |
| InChIKey | ILDCITGBIHYARB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|