C20H31NO5 — CID 20761298
3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]adamantane-1-carboxylic acid (PubChem CID 20761298) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]adamantane-1-carboxylic acid.
| Compound Name | 3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 20761298 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]adamantane-1-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)C12CC3CC(CC(C(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C20H31NO5/c1-4-18(2,3)17(25)26-6-5-21-15(22)19-8-13-7-14(9-19)11-20(10-13,12-19)16(23)24/h13-14H,4-12H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | ZTIWBTTXRUKLAV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|