C12H20N4O2 — CID 122207012
adamantane-1,3-dicarbohydrazide (PubChem CID 122207012) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is adamantane-1,3-dicarbohydrazide.
| Compound Name | adamantane-1,3-dicarbohydrazide |
|---|---|
| PubChem CID | 122207012 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | adamantane-1,3-dicarbohydrazide |
| SMILES | NNC(=O)C12CC3CC(C1)CC(C(=O)NN)(C3)C2 |
| InChI | InChI=1S/C12H20N4O2/c13-15-9(17)11-2-7-1-8(4-11)5-12(3-7,6-11)10(18)16-14/h7-8H,1-6,13-14H2,(H,15,17)(H,16,18) |
| InChIKey | HKXKSGCXHLYMKJ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|