C14H24N4O2 — CID 4171850
5,7-dimethyladamantane-1,3-dicarbohydrazide (PubChem CID 4171850) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5,7-dimethyladamantane-1,3-dicarbohydrazide.
| Compound Name | 5,7-dimethyladamantane-1,3-dicarbohydrazide |
|---|---|
| PubChem CID | 4171850 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 5,7-dimethyladamantane-1,3-dicarbohydrazide |
| SMILES | CC12CC3(C)CC(C(=O)NN)(C1)CC(C(=O)NN)(C2)C3 |
| InChI | InChI=1S/C14H24N4O2/c1-11-3-12(2)6-13(4-11,9(19)17-15)8-14(5-11,7-12)10(20)18-16/h3-8,15-16H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | BHURDCUZTVXINH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|