C11H18N2O2 — CID 24721604
(5S,7R)-3-hydroxyadamantane-1-carbohydrazide (PubChem CID 24721604) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (5S,7R)-3-hydroxyadamantane-1-carbohydrazide.
| Compound Name | (5S,7R)-3-hydroxyadamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 24721604 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (5S,7R)-3-hydroxyadamantane-1-carbohydrazide |
| SMILES | NNC(=O)C12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C11H18N2O2/c12-13-9(14)10-2-7-1-8(3-10)5-11(15,4-7)6-10/h7-8,15H,1-6,12H2,(H,13,14)/t7-,8+,10?,11? |
| InChIKey | ACBRUBTXNNBFBB-JZVMUCMXSA-N |
| XLogP | 0.31 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|