C18H22FNO2 — CID 2113814
(5S,7R)-N-(5-fluoro-2-methylphenyl)-3-hydroxyadamantane-1-carboxamide (PubChem CID 2113814) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is (5S,7R)-N-(5-fluoro-2-methylphenyl)-3-hydroxyadamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-(5-fluoro-2-methylphenyl)-3-hydroxyadamantane-1-carboxamide |
|---|---|
| PubChem CID | 2113814 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (5S,7R)-N-(5-fluoro-2-methylphenyl)-3-hydroxyadamantane-1-carboxamide |
| SMILES | Cc1ccc(F)cc1NC(=O)C12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H22FNO2/c1-11-2-3-14(19)5-15(11)20-16(21)17-6-12-4-13(7-17)9-18(22,8-12)10-17/h2-3,5,12-13,22H,4,6-10H2,1H3,(H,20,21)/t12-,13+,17?,18? |
| InChIKey | OOHDRYOLHAWNIK-NLKGSNSHSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |