C22H24N4O — CID 168542634
N-[5-(2,2-dicyanoethenylamino)-2-methylphenyl]adamantane-1-carboxamide (PubChem CID 168542634) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[5-(2,2-dicyanoethenylamino)-2-methylphenyl]adamantane-1-carboxamide.
| Compound Name | N-[5-(2,2-dicyanoethenylamino)-2-methylphenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 168542634 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[5-(2,2-dicyanoethenylamino)-2-methylphenyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(NC=C(C#N)C#N)cc1NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H24N4O/c1-14-2-3-19(25-13-18(11-23)12-24)7-20(14)26-21(27)22-8-15-4-16(9-22)6-17(5-15)10-22/h2-3,7,13,15-17,25H,4-6,8-10H2,1H3,(H,26,27) |
| InChIKey | JOFMEMKGTRBLFR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|