C21H23N7O — CID 169344492
N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]adamantane-1-carboxamide (PubChem CID 169344492) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 169344492 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]adamantane-1-carboxamide |
| SMILES | N#CC(=CNc1ccc(NC(=O)C23CC4CC(CC(C4)C2)C3)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C21H23N7O/c22-11-16(19-25-27-28-26-19)12-23-17-1-3-18(4-2-17)24-20(29)21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,12-15,23H,5-10H2,(H,24,29)(H,25,26,27,28) |
| InChIKey | DCZFFDDULKXJCJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|