C24H30N8O2 — CID 169343891
1-[2-(1-adamantyloxy)propyl]-3-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]urea (PubChem CID 169343891) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 1-[2-(1-adamantyloxy)propyl]-3-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]urea.
| Compound Name | 1-[2-(1-adamantyloxy)propyl]-3-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]urea |
|---|---|
| PubChem CID | 169343891 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 1-[2-(1-adamantyloxy)propyl]-3-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]urea |
| SMILES | CC(CNC(=O)Nc1cccc(NC=C(C#N)c2nn[nH]n2)c1)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H30N8O2/c1-15(34-24-9-16-5-17(10-24)7-18(6-16)11-24)13-27-23(33)28-21-4-2-3-20(8-21)26-14-19(12-25)22-29-31-32-30-22/h2-4,8,14-18,26H,5-7,9-11,13H2,1H3,(H2,27,28,33)(H,29,30,31,32) |
| InChIKey | VAKDMDMBZDFVLG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|