C16H24O6S2 — CID 158876554
(7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-dimethylbutanoylsulfanyl)acetate (PubChem CID 158876554) has the molecular formula C16H24O6S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-dimethylbutanoylsulfanyl)acetate.
| Compound Name | (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-dimethylbutanoylsulfanyl)acetate |
|---|---|
| PubChem CID | 158876554 |
| Molecular Formula | C16H24O6S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-dimethylbutanoylsulfanyl)acetate |
| SMILES | CCC(C)(C)C(=O)SCC(=O)OC1C2CC3C(C)(C2)C1OS3(=O)=O |
| InChI | InChI=1S/C16H24O6S2/c1-5-15(2,3)14(18)23-8-11(17)21-12-9-6-10-16(4,7-9)13(12)22-24(10,19)20/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | UIUXOFGGPOUTPS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|