C11H14F2O5S — CID 118068769
(7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate (PubChem CID 118068769) has the molecular formula C11H14F2O5S and a molecular weight of 296.29 g/mol. Its IUPAC name is (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate.
| Compound Name | (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 118068769 |
| Molecular Formula | C11H14F2O5S |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (7-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1C2CC3OS(=O)(=O)C1C3(C)C2 |
| InChI | InChI=1S/C11H14F2O5S/c1-10-4-5-3-6(10)18-19(15,16)8(10)7(5)17-9(14)11(2,12)13/h5-8H,3-4H2,1-2H3 |
| InChIKey | AMJHEWSTTMVSHJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|