C10H12F2O6S — CID 118068768
(3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate (PubChem CID 118068768) has the molecular formula C10H12F2O6S and a molecular weight of 298.26 g/mol. Its IUPAC name is (3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate.
| Compound Name | (3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 118068768 |
| Molecular Formula | C10H12F2O6S |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1C2CC3(C)OS(=O)(=O)C1C3O2 |
| InChI | InChI=1S/C10H12F2O6S/c1-9-3-4-5(17-8(13)10(2,11)12)6(7(9)16-4)19(14,15)18-9/h4-7H,3H2,1-2H3 |
| InChIKey | PSABJIICUQXEQH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|