C20H24O12S2 — CID 123593678
(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate;(3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) prop-2-enoate (PubChem CID 123593678) has the molecular formula C20H24O12S2 and a molecular weight of 520.53 g/mol. Its IUPAC name is (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate;(3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) prop-2-enoate.
| Compound Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate;(3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) prop-2-enoate |
|---|---|
| PubChem CID | 123593678 |
| Molecular Formula | C20H24O12S2 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate;(3-methyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) prop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2CC3OS(=O)(=O)C1C3O2.C=CC(=O)OC1C2CC3(C)OS(=O)(=O)C1C3O2 |
| InChI | InChI=1S/2C10H12O6S/c1-4(2)10(11)15-7-5-3-6-8(14-5)9(7)17(12,13)16-6;1-3-6(11)15-7-5-4-10(2)9(14-5)8(7)17(12,13)16-10/h5-9H,1,3H2,2H3;3,5,7-9H,1,4H2,2H3 |
| InChIKey | ZYEXBQPACSRSNU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|