C12H14O8S — CID 58264920
(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoyloxypropanoate (PubChem CID 58264920) has the molecular formula C12H14O8S and a molecular weight of 318.30 g/mol. Its IUPAC name is (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoyloxypropanoate.
| Compound Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 58264920 |
| Molecular Formula | C12H14O8S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OC(C)C(=O)OC1C2CC3C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C12H14O8S/c1-3-8(13)17-5(2)12(14)19-9-6-4-7-10(18-6)11(9)20-21(7,15)16/h3,5-7,9-11H,1,4H2,2H3 |
| InChIKey | JRWCZYLVNITJBS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|