C27H38O16S2 — CID 159584098
[2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;[2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate (PubChem CID 159584098) has the molecular formula C27H38O16S2 and a molecular weight of 682.72 g/mol. Its IUPAC name is [2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;[2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate.
| Compound Name | [2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;[2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 159584098 |
| Molecular Formula | C27H38O16S2 |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.16 |
| IUPAC Name | [2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;[2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1C2CC3C(O2)C1OS3(=O)=O.CCC(C)C(=O)OCC(=O)OC1C2CC3C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C14H20O8S.C13H18O8S/c1-4-14(2,3)13(16)19-6-9(15)21-10-7-5-8-11(20-7)12(10)22-23(8,17)18;1-3-6(2)13(15)18-5-9(14)20-10-7-4-8-11(19-7)12(10)21-22(8,16)17/h7-8,10-12H,4-6H2,1-3H3;6-8,10-12H,3-5H2,1-2H3 |
| InChIKey | MJJUOGRQPXGIED-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|