C12H15NO7S — CID 59623291
(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate (PubChem CID 59623291) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate.
| Compound Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate |
|---|---|
| PubChem CID | 59623291 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2-methylprop-2-enoylamino)acetate |
| SMILES | C=C(C)C(=O)NCC(=O)OC1C2CC3C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C12H15NO7S/c1-5(2)12(15)13-4-8(14)19-9-6-3-7-10(18-6)11(9)20-21(7,16)17/h6-7,9-11H,1,3-4H2,2H3,(H,13,15) |
| InChIKey | IMMFPHWKBBTKQE-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|