C8H8F2O9S2 — CID 88566773
2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 88566773) has the molecular formula C8H8F2O9S2 and a molecular weight of 350.27 g/mol. Its IUPAC name is 2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88566773 |
| Molecular Formula | C8H8F2O9S2 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 2-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OC1C2CC3C(O2)C1OS3(=O)=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H8F2O9S2/c9-8(10,21(14,15)16)7(11)18-4-2-1-3-5(17-2)6(4)19-20(3,12)13/h2-6H,1H2,(H,14,15,16) |
| InChIKey | CDOFMUYVGITVNL-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|