C9H12O9S2 — CID 90246297
3-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-3-oxopropane-1-sulfonic acid (PubChem CID 90246297) has the molecular formula C9H12O9S2 and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 90246297 |
| Molecular Formula | C9H12O9S2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 3-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-3-oxopropane-1-sulfonic acid |
| SMILES | O=C(CCS(=O)(=O)O)OC1C2CC3C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C9H12O9S2/c10-6(1-2-19(11,12)13)17-7-4-3-5-8(16-4)9(7)18-20(5,14)15/h4-5,7-9H,1-3H2,(H,11,12,13) |
| InChIKey | SSECYNOLKUDEQM-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|