C11H17ClO5S — CID 58264898
(3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 3-chloropropanoate (PubChem CID 58264898) has the molecular formula C11H17ClO5S and a molecular weight of 296.77 g/mol. Its IUPAC name is (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 3-chloropropanoate.
| Compound Name | (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 3-chloropropanoate |
|---|---|
| PubChem CID | 58264898 |
| Molecular Formula | C11H17ClO5S |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (3,8-dimethyl-7,7-dioxo-6-oxa-7λ6-thiabicyclo[3.2.1]octan-4-yl) 3-chloropropanoate |
| SMILES | CC1CC2C(C)C(OS2(=O)=O)C1OC(=O)CCCl |
| InChI | InChI=1S/C11H17ClO5S/c1-6-5-8-7(2)11(17-18(8,14)15)10(6)16-9(13)3-4-12/h6-8,10-11H,3-5H2,1-2H3 |
| InChIKey | VFTZMCJUZPCCBK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|