C13H16O7S — CID 59623140
[2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 59623140) has the molecular formula C13H16O7S and a molecular weight of 316.33 g/mol. Its IUPAC name is [2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 59623140 |
| Molecular Formula | C13H16O7S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC1C2CC3C(OS(=O)(=O)C31)C2C |
| InChI | InChI=1S/C13H16O7S/c1-3-9(14)18-5-10(15)19-12-7-4-8-11(6(7)2)20-21(16,17)13(8)12/h3,6-8,11-13H,1,4-5H2,2H3 |
| InChIKey | QIRCYQCOVRTWSA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|