C10H14O5S — CID 59638097
[2-(1,4-oxathiepan-3-yloxy)-2-oxoethyl] prop-2-enoate (PubChem CID 59638097) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is [2-(1,4-oxathiepan-3-yloxy)-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-(1,4-oxathiepan-3-yloxy)-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 59638097 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [2-(1,4-oxathiepan-3-yloxy)-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC1COCCCS1 |
| InChI | InChI=1S/C10H14O5S/c1-2-8(11)14-6-9(12)15-10-7-13-4-3-5-16-10/h2,10H,1,3-7H2 |
| InChIKey | VVOQLOYLBDHAMA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|