About 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane
3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane (PubChem CID 89163439) has the molecular formula C8H13BrO2S
and a molecular weight of 253.16 g/mol. Its IUPAC name is 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane.
Molecular Properties
| Compound Name | 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane |
| PubChem CID | 89163439 |
| Molecular Formula | C8H13BrO2S |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane |
| SMILES | C=C(CBr)OC1COCCCS1 |
| InChI | InChI=1S/C8H13BrO2S/c1-7(5-9)11-8-6-10-3-2-4-12-8/h8H,1-6H2 |
| InChIKey | OLDWJGUQGUGFMZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane?
The IUPAC name of 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane (CID 89163439) is 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane.
What is the SMILES notation for 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane?
The canonical SMILES for 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane is C=C(CBr)OC1COCCCS1.
What is the InChIKey of 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane?
The InChIKey is OLDWJGUQGUGFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrO2S/c1-7(5-9)11-8-6-10-3-2-4-12-8/h8H,1-6H2.
What are the key properties of 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane?
3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane has a molecular weight of 253.16 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane is sourced from PubChem (CID 89163439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).