C8H13BrO2S — CID 89163439
3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane (PubChem CID 89163439) has the molecular formula C8H13BrO2S and a molecular weight of 253.16 g/mol. Its IUPAC name is 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane.
| Compound Name | 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane |
|---|---|
| PubChem CID | 89163439 |
| Molecular Formula | C8H13BrO2S |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 3-(3-bromoprop-1-en-2-yloxy)-1,4-oxathiepane |
| SMILES | C=C(CBr)OC1COCCCS1 |
| InChI | InChI=1S/C8H13BrO2S/c1-7(5-9)11-8-6-10-3-2-4-12-8/h8H,1-6H2 |
| InChIKey | OLDWJGUQGUGFMZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|