About 1,4-oxathian-3-yl 2-oxoacetate
1,4-oxathian-3-yl 2-oxoacetate (PubChem CID 89393968) has the molecular formula C6H8O4S
and a molecular weight of 176.19 g/mol. Its IUPAC name is 1,4-oxathian-3-yl 2-oxoacetate.
Molecular Properties
| Compound Name | 1,4-oxathian-3-yl 2-oxoacetate |
| PubChem CID | 89393968 |
| Molecular Formula | C6H8O4S |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | 1,4-oxathian-3-yl 2-oxoacetate |
| SMILES | O=CC(=O)OC1COCCS1 |
| InChI | InChI=1S/C6H8O4S/c7-3-5(8)10-6-4-9-1-2-11-6/h3,6H,1-2,4H2 |
| InChIKey | CZIASWVEGGAFIE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-oxathian-3-yl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-oxathian-3-yl 2-oxoacetate?
The IUPAC name of 1,4-oxathian-3-yl 2-oxoacetate (CID 89393968) is 1,4-oxathian-3-yl 2-oxoacetate.
What is the SMILES notation for 1,4-oxathian-3-yl 2-oxoacetate?
The canonical SMILES for 1,4-oxathian-3-yl 2-oxoacetate is O=CC(=O)OC1COCCS1.
What is the InChIKey of 1,4-oxathian-3-yl 2-oxoacetate?
The InChIKey is CZIASWVEGGAFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4S/c7-3-5(8)10-6-4-9-1-2-11-6/h3,6H,1-2,4H2.
What are the key properties of 1,4-oxathian-3-yl 2-oxoacetate?
1,4-oxathian-3-yl 2-oxoacetate has a molecular weight of 176.19 g/mol, XLogP of -0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-oxathian-3-yl 2-oxoacetate is sourced from PubChem (CID 89393968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).