C6H10O3S — CID 117274231
1,4-oxathiepane-6-carboxylic acid (PubChem CID 117274231) has the molecular formula C6H10O3S and a molecular weight of 162.21 g/mol. Its IUPAC name is 1,4-oxathiepane-6-carboxylic acid.
| Compound Name | 1,4-oxathiepane-6-carboxylic acid |
|---|---|
| PubChem CID | 117274231 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1,4-oxathiepane-6-carboxylic acid |
| SMILES | O=C(O)C1COCCSC1 |
| InChI | InChI=1S/C6H10O3S/c7-6(8)5-3-9-1-2-10-4-5/h5H,1-4H2,(H,7,8) |
| InChIKey | VNUVJJBAKQWCPY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |