C10H15NO4S — CID 62758263
3-(oxane-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 62758263) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-(oxane-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(oxane-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 62758263 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-(oxane-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSCN1C(=O)C1CCCOC1 |
| InChI | InChI=1S/C10H15NO4S/c12-9(7-2-1-3-15-4-7)11-6-16-5-8(11)10(13)14/h7-8H,1-6H2,(H,13,14) |
| InChIKey | BDHPVBDBYOWRLH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |