C6H10O4 — CID 68653500
(3S,5S)-5-hydroxyoxane-3-carboxylic acid (PubChem CID 68653500) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (3S,5S)-5-hydroxyoxane-3-carboxylic acid.
| Compound Name | (3S,5S)-5-hydroxyoxane-3-carboxylic acid |
|---|---|
| PubChem CID | 68653500 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (3S,5S)-5-hydroxyoxane-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1COC[C@@H](O)C1 |
| InChI | InChI=1S/C6H10O4/c7-5-1-4(6(8)9)2-10-3-5/h4-5,7H,1-3H2,(H,8,9)/t4-,5-/m0/s1 |
| InChIKey | PCDZNDBQJQHKCJ-WHFBIAKZSA-N |
| XLogP | -0.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |