About 1,3-oxathiolan-5-yl 2-oxoacetate
1,3-oxathiolan-5-yl 2-oxoacetate (PubChem CID 89393967) has the molecular formula C5H6O4S
and a molecular weight of 162.17 g/mol. Its IUPAC name is 1,3-oxathiolan-5-yl 2-oxoacetate.
Molecular Properties
| Compound Name | 1,3-oxathiolan-5-yl 2-oxoacetate |
| PubChem CID | 89393967 |
| Molecular Formula | C5H6O4S |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | 1,3-oxathiolan-5-yl 2-oxoacetate |
| SMILES | O=CC(=O)OC1CSCO1 |
| InChI | InChI=1S/C5H6O4S/c6-1-4(7)9-5-2-10-3-8-5/h1,5H,2-3H2 |
| InChIKey | IPZCTCSAJJGVKM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-oxathiolan-5-yl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxathiolan-5-yl 2-oxoacetate?
The IUPAC name of 1,3-oxathiolan-5-yl 2-oxoacetate (CID 89393967) is 1,3-oxathiolan-5-yl 2-oxoacetate.
What is the SMILES notation for 1,3-oxathiolan-5-yl 2-oxoacetate?
The canonical SMILES for 1,3-oxathiolan-5-yl 2-oxoacetate is O=CC(=O)OC1CSCO1.
What is the InChIKey of 1,3-oxathiolan-5-yl 2-oxoacetate?
The InChIKey is IPZCTCSAJJGVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4S/c6-1-4(7)9-5-2-10-3-8-5/h1,5H,2-3H2.
What are the key properties of 1,3-oxathiolan-5-yl 2-oxoacetate?
1,3-oxathiolan-5-yl 2-oxoacetate has a molecular weight of 162.17 g/mol, XLogP of -0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxathiolan-5-yl 2-oxoacetate is sourced from PubChem (CID 89393967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).