C5H6O4S — CID 89393967
1,3-oxathiolan-5-yl 2-oxoacetate (PubChem CID 89393967) has the molecular formula C5H6O4S and a molecular weight of 162.17 g/mol. Its IUPAC name is 1,3-oxathiolan-5-yl 2-oxoacetate.
| Compound Name | 1,3-oxathiolan-5-yl 2-oxoacetate |
|---|---|
| PubChem CID | 89393967 |
| Molecular Formula | C5H6O4S |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | 1,3-oxathiolan-5-yl 2-oxoacetate |
| SMILES | O=CC(=O)OC1CSCO1 |
| InChI | InChI=1S/C5H6O4S/c6-1-4(7)9-5-2-10-3-8-5/h1,5H,2-3H2 |
| InChIKey | IPZCTCSAJJGVKM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|