About morpholin-2-yl prop-2-enoate
morpholin-2-yl prop-2-enoate (PubChem CID 22497789) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is morpholin-2-yl prop-2-enoate.
Molecular Properties
| Compound Name | morpholin-2-yl prop-2-enoate |
| PubChem CID | 22497789 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | morpholin-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1CNCCO1 |
| InChI | InChI=1S/C7H11NO3/c1-2-6(9)11-7-5-8-3-4-10-7/h2,7-8H,1,3-5H2 |
| InChIKey | SZXGJSNIZUWVDJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze morpholin-2-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-2-yl prop-2-enoate?
The IUPAC name of morpholin-2-yl prop-2-enoate (CID 22497789) is morpholin-2-yl prop-2-enoate.
What is the SMILES notation for morpholin-2-yl prop-2-enoate?
The canonical SMILES for morpholin-2-yl prop-2-enoate is C=CC(=O)OC1CNCCO1.
What is the InChIKey of morpholin-2-yl prop-2-enoate?
The InChIKey is SZXGJSNIZUWVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-6(9)11-7-5-8-3-4-10-7/h2,7-8H,1,3-5H2.
What are the key properties of morpholin-2-yl prop-2-enoate?
morpholin-2-yl prop-2-enoate has a molecular weight of 157.17 g/mol, XLogP of -0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-yl prop-2-enoate is sourced from PubChem (CID 22497789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).