About morpholin-2-yl hydrogen carbonate
morpholin-2-yl hydrogen carbonate (PubChem CID 70064874) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is morpholin-2-yl hydrogen carbonate.
Molecular Properties
| Compound Name | morpholin-2-yl hydrogen carbonate |
| PubChem CID | 70064874 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | morpholin-2-yl hydrogen carbonate |
| SMILES | O=C(O)OC1CNCCO1 |
| InChI | InChI=1S/C5H9NO4/c7-5(8)10-4-3-6-1-2-9-4/h4,6H,1-3H2,(H,7,8) |
| InChIKey | BJOWZFYEYOZIIX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze morpholin-2-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-2-yl hydrogen carbonate?
The IUPAC name of morpholin-2-yl hydrogen carbonate (CID 70064874) is morpholin-2-yl hydrogen carbonate.
What is the SMILES notation for morpholin-2-yl hydrogen carbonate?
The canonical SMILES for morpholin-2-yl hydrogen carbonate is O=C(O)OC1CNCCO1.
What is the InChIKey of morpholin-2-yl hydrogen carbonate?
The InChIKey is BJOWZFYEYOZIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4/c7-5(8)10-4-3-6-1-2-9-4/h4,6H,1-3H2,(H,7,8).
What are the key properties of morpholin-2-yl hydrogen carbonate?
morpholin-2-yl hydrogen carbonate has a molecular weight of 147.13 g/mol, XLogP of -0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-yl hydrogen carbonate is sourced from PubChem (CID 70064874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).