About morpholin-2-yl carbamate
morpholin-2-yl carbamate (PubChem CID 165011060) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is morpholin-2-yl carbamate.
Molecular Properties
| Compound Name | morpholin-2-yl carbamate |
| PubChem CID | 165011060 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | morpholin-2-yl carbamate |
| SMILES | NC(=O)OC1CNCCO1 |
| InChI | InChI=1S/C5H10N2O3/c6-5(8)10-4-3-7-1-2-9-4/h4,7H,1-3H2,(H2,6,8) |
| InChIKey | JSCGJBVNXUBBLK-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze morpholin-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-2-yl carbamate?
The IUPAC name of morpholin-2-yl carbamate (CID 165011060) is morpholin-2-yl carbamate.
What is the SMILES notation for morpholin-2-yl carbamate?
The canonical SMILES for morpholin-2-yl carbamate is NC(=O)OC1CNCCO1.
What is the InChIKey of morpholin-2-yl carbamate?
The InChIKey is JSCGJBVNXUBBLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3/c6-5(8)10-4-3-7-1-2-9-4/h4,7H,1-3H2,(H2,6,8).
What are the key properties of morpholin-2-yl carbamate?
morpholin-2-yl carbamate has a molecular weight of 146.15 g/mol, XLogP of -0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-yl carbamate is sourced from PubChem (CID 165011060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).