About 1-morpholin-2-ylethyl prop-2-enoate
1-morpholin-2-ylethyl prop-2-enoate (PubChem CID 22556289) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 1-morpholin-2-ylethyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-morpholin-2-ylethyl prop-2-enoate |
| PubChem CID | 22556289 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 1-morpholin-2-ylethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C1CNCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-3-9(11)13-7(2)8-6-10-4-5-12-8/h3,7-8,10H,1,4-6H2,2H3 |
| InChIKey | SKIBKQCQLGTNTI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-morpholin-2-ylethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-2-ylethyl prop-2-enoate?
The IUPAC name of 1-morpholin-2-ylethyl prop-2-enoate (CID 22556289) is 1-morpholin-2-ylethyl prop-2-enoate.
What is the SMILES notation for 1-morpholin-2-ylethyl prop-2-enoate?
The canonical SMILES for 1-morpholin-2-ylethyl prop-2-enoate is C=CC(=O)OC(C)C1CNCCO1.
What is the InChIKey of 1-morpholin-2-ylethyl prop-2-enoate?
The InChIKey is SKIBKQCQLGTNTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-3-9(11)13-7(2)8-6-10-4-5-12-8/h3,7-8,10H,1,4-6H2,2H3.
What are the key properties of 1-morpholin-2-ylethyl prop-2-enoate?
1-morpholin-2-ylethyl prop-2-enoate has a molecular weight of 185.22 g/mol, XLogP of 0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-2-ylethyl prop-2-enoate is sourced from PubChem (CID 22556289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).