C11H16O5 — CID 174631406
2-methylprop-2-enoic acid;1-(oxiran-2-yl)ethyl prop-2-enoate (PubChem CID 174631406) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;1-(oxiran-2-yl)ethyl prop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;1-(oxiran-2-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 174631406 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-methylprop-2-enoic acid;1-(oxiran-2-yl)ethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OC(C)C1CO1 |
| InChI | InChI=1S/C7H10O3.C4H6O2/c1-3-7(8)10-5(2)6-4-9-6;1-3(2)4(5)6/h3,5-6H,1,4H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | MZRLJWIRTYABFI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|