C13H20O6 — CID 174491978
oxiran-2-ylmethanol;2-prop-2-enoyloxypropyl 2-methylprop-2-enoate (PubChem CID 174491978) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is oxiran-2-ylmethanol;2-prop-2-enoyloxypropyl 2-methylprop-2-enoate.
| Compound Name | oxiran-2-ylmethanol;2-prop-2-enoyloxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174491978 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | oxiran-2-ylmethanol;2-prop-2-enoyloxypropyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC(C)COC(=O)C(=C)C.OCC1CO1 |
| InChI | InChI=1S/C10H14O4.C3H6O2/c1-5-9(11)14-8(4)6-13-10(12)7(2)3;4-1-3-2-5-3/h5,8H,1-2,6H2,3-4H3;3-4H,1-2H2 |
| InChIKey | ZDKJUERUXZVCPX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|