C18H32O10 — CID 174974032
ethane-1,2-diol;1-(2-methoxyethoxy)ethyl prop-2-enoate;bis(2-methylprop-2-enoic acid) (PubChem CID 174974032) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is ethane-1,2-diol;1-(2-methoxyethoxy)ethyl prop-2-enoate;bis(2-methylprop-2-enoic acid).
| Compound Name | ethane-1,2-diol;1-(2-methoxyethoxy)ethyl prop-2-enoate;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 174974032 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | ethane-1,2-diol;1-(2-methoxyethoxy)ethyl prop-2-enoate;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=CC(=O)OC(C)OCCOC.OCCO |
| InChI | InChI=1S/C8H14O4.2C4H6O2.C2H6O2/c1-4-8(9)12-7(2)11-6-5-10-3;2*1-3(2)4(5)6;3-1-2-4/h4,7H,1,5-6H2,2-3H3;2*1H2,2H3,(H,5,6);3-4H,1-2H2 |
| InChIKey | NDMPBDOIKWKAGF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|