C12H18NO4+ — CID 87997397
dimethyl-[2-methylprop-2-enoyloxy(oxiran-2-yl)methyl]-prop-2-enoylazanium (PubChem CID 87997397) has the molecular formula C12H18NO4+ and a molecular weight of 240.28 g/mol. Its IUPAC name is dimethyl-[2-methylprop-2-enoyloxy(oxiran-2-yl)methyl]-prop-2-enoylazanium.
| Compound Name | dimethyl-[2-methylprop-2-enoyloxy(oxiran-2-yl)methyl]-prop-2-enoylazanium |
|---|---|
| PubChem CID | 87997397 |
| Molecular Formula | C12H18NO4+ |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | dimethyl-[2-methylprop-2-enoyloxy(oxiran-2-yl)methyl]-prop-2-enoylazanium |
| SMILES | C=CC(=O)[N+](C)(C)C(OC(=O)C(=C)C)C1CO1 |
| InChI | InChI=1S/C12H18NO4/c1-6-10(14)13(4,5)11(9-7-16-9)17-12(15)8(2)3/h6,9,11H,1-2,7H2,3-5H3/q+1 |
| InChIKey | UXJBAWSGBIOWAS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|