C12H16O5 — CID 87060204
6-(2-methylprop-2-enoyloxy)-6-(oxiran-2-yl)hex-2-enoic acid (PubChem CID 87060204) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 6-(2-methylprop-2-enoyloxy)-6-(oxiran-2-yl)hex-2-enoic acid.
| Compound Name | 6-(2-methylprop-2-enoyloxy)-6-(oxiran-2-yl)hex-2-enoic acid |
|---|---|
| PubChem CID | 87060204 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 6-(2-methylprop-2-enoyloxy)-6-(oxiran-2-yl)hex-2-enoic acid |
| SMILES | C=C(C)C(=O)OC(CCC=CC(=O)O)C1CO1 |
| InChI | InChI=1S/C12H16O5/c1-8(2)12(15)17-9(10-7-16-10)5-3-4-6-11(13)14/h4,6,9-10H,1,3,5,7H2,2H3,(H,13,14) |
| InChIKey | YVIBSKSDTGKLIE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|