C18H24O6 — CID 175572445
2-methyl-3-(oxiran-2-ylmethyl)penta-2,4-dienoic acid;1-(oxiran-2-yl)prop-2-enyl 2-methylprop-2-enoate (PubChem CID 175572445) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-methyl-3-(oxiran-2-ylmethyl)penta-2,4-dienoic acid;1-(oxiran-2-yl)prop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 2-methyl-3-(oxiran-2-ylmethyl)penta-2,4-dienoic acid;1-(oxiran-2-yl)prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175572445 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-methyl-3-(oxiran-2-ylmethyl)penta-2,4-dienoic acid;1-(oxiran-2-yl)prop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=CC(CC1CO1)=C(C)C(=O)O.C=CC(OC(=O)C(=C)C)C1CO1 |
| InChI | InChI=1S/2C9H12O3/c1-4-7(8-5-11-8)12-9(10)6(2)3;1-3-7(4-8-5-12-8)6(2)9(10)11/h4,7-8H,1-2,5H2,3H3;3,8H,1,4-5H2,2H3,(H,10,11) |
| InChIKey | ZLMCFCRNCKBKSJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|