C17H24O5 — CID 174889097
but-2-enyl prop-2-enoate;1-(oxiran-2-yl)ethyl prop-2-enoate;propa-1,2-diene (PubChem CID 174889097) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is but-2-enyl prop-2-enoate;1-(oxiran-2-yl)ethyl prop-2-enoate;propa-1,2-diene.
| Compound Name | but-2-enyl prop-2-enoate;1-(oxiran-2-yl)ethyl prop-2-enoate;propa-1,2-diene |
|---|---|
| PubChem CID | 174889097 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | but-2-enyl prop-2-enoate;1-(oxiran-2-yl)ethyl prop-2-enoate;propa-1,2-diene |
| SMILES | C=C=C.C=CC(=O)OC(C)C1CO1.C=CC(=O)OCC=CC |
| InChI | InChI=1S/C7H10O3.C7H10O2.C3H4/c1-3-7(8)10-5(2)6-4-9-6;1-3-5-6-9-7(8)4-2;1-3-2/h3,5-6H,1,4H2,2H3;3-5H,2,6H2,1H3;1-2H2 |
| InChIKey | XJCJYUJMIZOKOV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|