About but-2-enyl prop-2-enoate;but-2-ynoic acid
but-2-enyl prop-2-enoate;but-2-ynoic acid (PubChem CID 175408783) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is but-2-enyl prop-2-enoate;but-2-ynoic acid.
Molecular Properties
| Compound Name | but-2-enyl prop-2-enoate;but-2-ynoic acid |
| PubChem CID | 175408783 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | but-2-enyl prop-2-enoate;but-2-ynoic acid |
| SMILES | C=CC(=O)OCC=CC.CC#CC(=O)O |
| InChI | InChI=1S/C7H10O2.C4H4O2/c1-3-5-6-9-7(8)4-2;1-2-3-4(5)6/h3-5H,2,6H2,1H3;1H3,(H,5,6) |
| InChIKey | WFWACOGKKVEGCB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-enyl prop-2-enoate;but-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enyl prop-2-enoate;but-2-ynoic acid?
The IUPAC name of but-2-enyl prop-2-enoate;but-2-ynoic acid (CID 175408783) is but-2-enyl prop-2-enoate;but-2-ynoic acid.
What is the SMILES notation for but-2-enyl prop-2-enoate;but-2-ynoic acid?
The canonical SMILES for but-2-enyl prop-2-enoate;but-2-ynoic acid is C=CC(=O)OCC=CC.CC#CC(=O)O.
What is the InChIKey of but-2-enyl prop-2-enoate;but-2-ynoic acid?
The InChIKey is WFWACOGKKVEGCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2.C4H4O2/c1-3-5-6-9-7(8)4-2;1-2-3-4(5)6/h3-5H,2,6H2,1H3;1H3,(H,5,6).
What are the key properties of but-2-enyl prop-2-enoate;but-2-ynoic acid?
but-2-enyl prop-2-enoate;but-2-ynoic acid has a molecular weight of 210.23 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enyl prop-2-enoate;but-2-ynoic acid is sourced from PubChem (CID 175408783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).