About but-2-enyl prop-2-enoate;ethene;trimethoxysilane
but-2-enyl prop-2-enoate;ethene;trimethoxysilane (PubChem CID 174451468) has the molecular formula C12H24O5Si
and a molecular weight of 276.41 g/mol. Its IUPAC name is but-2-enyl prop-2-enoate;ethene;trimethoxysilane.
Molecular Properties
| Compound Name | but-2-enyl prop-2-enoate;ethene;trimethoxysilane |
| PubChem CID | 174451468 |
| Molecular Formula | C12H24O5Si |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | but-2-enyl prop-2-enoate;ethene;trimethoxysilane |
| SMILES | C=C.C=CC(=O)OCC=CC.CO[SiH](OC)OC |
| InChI | InChI=1S/C7H10O2.C3H10O3Si.C2H4/c1-3-5-6-9-7(8)4-2;1-4-7(5-2)6-3;1-2/h3-5H,2,6H2,1H3;7H,1-3H3;1-2H2 |
| InChIKey | UEOWLGFGNLNAAZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enyl prop-2-enoate;ethene;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enyl prop-2-enoate;ethene;trimethoxysilane?
The IUPAC name of but-2-enyl prop-2-enoate;ethene;trimethoxysilane (CID 174451468) is but-2-enyl prop-2-enoate;ethene;trimethoxysilane.
What is the SMILES notation for but-2-enyl prop-2-enoate;ethene;trimethoxysilane?
The canonical SMILES for but-2-enyl prop-2-enoate;ethene;trimethoxysilane is C=C.C=CC(=O)OCC=CC.CO[SiH](OC)OC.
What is the InChIKey of but-2-enyl prop-2-enoate;ethene;trimethoxysilane?
The InChIKey is UEOWLGFGNLNAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2.C3H10O3Si.C2H4/c1-3-5-6-9-7(8)4-2;1-4-7(5-2)6-3;1-2/h3-5H,2,6H2,1H3;7H,1-3H3;1-2H2.
What are the key properties of but-2-enyl prop-2-enoate;ethene;trimethoxysilane?
but-2-enyl prop-2-enoate;ethene;trimethoxysilane has a molecular weight of 276.41 g/mol, XLogP of 1.74, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enyl prop-2-enoate;ethene;trimethoxysilane is sourced from PubChem (CID 174451468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).